No language detected.
Please check the input language, no language detected.
Please check the input language.
Molar concentration (molarity, M): confiscation of solutes contained in 1L volume of solution = Confiscation of solutes/Volume of solution Molar concentration of solution (molarity, M): Confiscation of solutes contained in 1L volume of solution = confiscation of solutes/volume of solution
인기글
No language detected.
Please check the input language, no language detected.
Please check the input language.
Mixture mass percentage and mole percentage, mixture mass percentage and mole percentage Agas mixture has the following percentages by mass:N2:70% O2:14% CO:4% CO2:12% What are the mole fractions of the mixture? ———————————————- For this type of problem with %(percentage), assuming the total amount of mixture (or sample) used in the measurement is 100g, you can immediately change the % value to g value…ywpop.tistory.com Mixture mass percentage and mole percentage Agas mix has the following percentages by mass:N2:70% O2:14% CO:12% CO:4% CO:12% of the mass of the mixture? ———————————————- This type of problem associated with %(percentage) can be used immediately by changing the % value to the g value if the total mixture (or sample) used for the measurement is assumed to be 100g…ywpop.tistory.com
※ Learn the formula for molal concentration and molal concentration accurately! + g/cm3 = g/mL dilution : a formula for reducing a thick storage solution to the desired molal concentration (considered dilution) by adding a solvent : Moral concentration before dilution (M1) * Moral concentration before dilution (M2) * Volume after dilution (V2) Chemical reaction type ①binding reaction = A+B→AB→AB②decomposition reaction=AB=AB+A+B+C substitution→ABC reaction=AB+AC substitution+C, precipitation reaction)⑧ Gaseous formation reaction ⑨ oxidation-reduction reaction precipitation reaction = prediction of the formation of a reaction precipitation in which a soluble compound reacts to form an insoluble product (precipitation) Step 3: Confirmation of reactant ions → The idea of combining cations and anions as much as possible→ We found insoluble combinations in it ※ Learn the formula for molal concentration and molal concentration accurately! + g/cm3 = g/mL dilution : a formula for reducing a thick storage solution to the desired molal concentration (considered dilution) by adding a solvent : Moral concentration before dilution (M1) * Moral concentration before dilution (M2) * Volume after dilution (V2) Chemical reaction type ①binding reaction = A+B→AB→AB②decomposition reaction=AB=AB+A+B+C substitution→ABC reaction=AB+AC substitution+C, precipitation reaction)⑧ Gaseous formation reaction ⑨ oxidation-reduction reaction precipitation reaction = prediction of the formation of a reaction precipitation in which a soluble compound reacts to form an insoluble product (precipitation) Step 3: Confirmation of reactant ions → The idea of combining cations and anions as much as possible→ We found insoluble combinations in it
It was solved in the end ;;;https://ywpop.tistory.com/19663 (One day later) It was solved in the end ;;https://ywpop.tistory.com/19663
In the experiment, 0.270 M barium hydroxide 45.0 mL + 0.330 M aluminum sulfate 28.0 mL total mass Ba(OH)2 + Al2(SO4)3 + Ba(OH)2 total mass of 0.270 M barium hydroxide 45.0 mL + 0.330 M aluminum sulfate 28.0 mL precipitate, A 0.270 M barium hydroxide solution of 45.0 mL was mixed with a 0.330 M aluminum sulfate solution of 28.0 mL. Answer the following questions. What is the total mass of the precipitate produced? ————————————————— > (0.270 mol/L) (45.0/1000 L) = 0.01215 mol Ba(OH)2 > (…ywpop.tistory.com 0.270M barium hydroxide 45.0mL+0.330M barium hydroxide 28.0mL precipitate 0.270M barium hydroxide 45.0mL+0.330M barium hydroxide 28.0mL+0.330M barium sulfate 28.0mL precipitate Ba(OH)2+Al2(SO4)3+Ba(OH)2, A 0.270 M barium hydroxide solution of 45.0 mL was mixed with a 0.330 M aluminum sulfate solution of 28.0 mL. Answer the following questions. What is the total mass of the precipitate produced? ————————————————— > (0.270 mol/L) (45.0/1000 L) = 0.01215 mol Ba(OH)2 > (···ywpop.tistory.com
There is a similar example. Acid-base reaction acid = substance base that produces H+ when dissolved in water = substance-base reaction that produces OH- when dissolved in water = neutralization reaction: acid + base → salt (NaCl) + water (H2O) weak acid has low dissociation (*dissociation = separation). Antonyms of ionic bonds) Hydroxylated ions react completely with any acid https://m.blog.naver.com/dlsnditi7541/221213322415 There is a similar example. Acid-base reaction acid = substance base that produces H+ when dissolved in water = substance-base reaction = neutralization reaction: acid+base → salt (NaCl) + water (H2O) weak acid dissociates from ionic reaction = dissociation. antonym of ionic bonding) Hydroxylated ions are strong bases, so they react completely with any acid https://m.blog.naver.com/dlsnditi7541/221213322415
Chapter 4. Acid-base reactions, neutralization reactions, and in this posting, we will learn about acids, bases and their characteristics, and we will deal with acid-base neutralization reactions. 저번 m.blog.naver.com Chapter 4. Acid-base reactions, neutralization reactions, and this posting will learn about acids, bases and their characteristics, and we will even deal with acid-base neutralization reactions. 저번 …m.blog.naver.com
* an acid-base that can be calculated by using a granular ion reaction formula = H+(aq)+OH-(aq)→H2O(l) such as H and OH confiscation APPROPRIATE = VOLUME ANALYSIS METHOD FOR DETERMINING CONCENTRATION OF OTHER SOLUTION NOT CONCENTRATED BY CHEMICAL REACTION USING SOLUTION IN WHICH CONCENTR a charge that is carried when a reaction (oxidation and reduction) in which one or more electrons move in an oxidation-reduction reaction is completely transferred * an acid-base that can be calculated by using a granular ion reaction formula = H+(aq)+OH-(aq)→H2O(l) such as H and OH confiscation APPROPRIATE = VOLUME ANALYSIS METHOD FOR DETERMINING CONCENTRATION OF OTHER SOLUTION NOT CONCENTRATED BY CHEMICAL REACTION USING SOLUTION IN WHICH CONCENTR a charge that is carried when a reaction (oxidation and reduction) in which one or more electrons move in an oxidation-reduction reaction is completely transferred
I’m not sure what this table is about;; characteristics of oxidation-reduction reactions = transfer oxidation of electrons = lose an electron reduction = obtain electrons Oxidizing agent = receives electrons. A substance (ex. Cl2, O2) reducing agent = electron is given which takes electrons from a substance oxidizing the relative reactant or from the relative reactant. Substances that reduce relative reactants or substances that give electrons to relative reactants (ex.Na, CH4) have a problem of matching redox ratios The next five units will be advanced, and I have too much to memorize, but the examination is only two days away. Shvalshvalshvalshvalshvalshvalsh!! I’m not sure what this table is about;; characteristics of oxidation-reduction reactions = transfer oxidation of electrons = lose an electron reduction = obtain electrons Oxidizing agent = receives electrons. A substance (ex. Cl2, O2) reducing agent = electron is given which takes electrons from a substance oxidizing the relative reactant or from the relative reactant. Substances that reduce relative reactants or substances that give electrons to relative reactants (ex.Na, CH4) have a problem of matching redox ratios The next five units will be advanced, and I have too much to memorize, but the examination is only two days away. Shvalshvalshvalshvalshvalshvalsh!!